Jump to content

4,4'-Methylenedianiline: Difference between revisions

Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').
 
(74 intermediate revisions by 42 users not shown)
Line 1: Line 1:
{{cs1 config|name-list-style=vanc}}
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456502017
| Name = 4,4′-Methylenedianiline
| ImageFile = 4-4'-methylenedianiline.svg
| ImageFile = 4-4'-methylenedianiline.svg
| ImageSize = 200px
| ImageSize = 200px
| ImageName =
| ImageName =
| PIN = 4,4′-Methylenedianiline
| IUPACName = Bis(4-aminophenyl)methane
| OtherNames = 4,4'-Diaminodiphenylmethane; 4,4'-Methylenebisbenzenamine; MDA
| OtherNames =
4,-Diaminodiphenylmethane
4,-Methylenebisbenzenamine
''para'',''para''′-Diaminodiphenylmethane <br>
Dianilinomethane <br>
4,4′-Diphenylmethanediamine <br>
Bis(4-aminophenyl)methane
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| CASNo = 101-77-9
| CASNo = 101-77-9
| CASNo_Ref = {{cascite}}
| CASNo_Ref = {{cascite}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID =
| EINECS = 202-974-4
| EINECS = 202-974-4
| EC = 612-051-00-1
| =
| PubChem = 7577
| =
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 85728 -->
| ChEMBL = 85728
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite||kegg}}
| KEGG = <!-- blanked - oldvalue: C14288 -->
| UNII = GG5LL7OBZC
| =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = GG5LL7OBZC
| SMILES = c1cc(N)ccc1Cc2ccc(N)cc2
| SMILES = c1cc(N)ccc1Cc2ccc(N)cc2
| ChemSpiderID =
| InChI = InChI=1/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2
| InChI = 1/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2
| RTECS = BY5425000
| InChIKey = YBRVSVVVWCFQMG-UHFFFAOYAE
| UN = 2651}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = YBRVSVVVWCFQMG-UHFFFAOYSA-N
| MeSHName =
| RTECS = BY5425000
| = 2651}}
| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| C=13|H=16|N=2
| C=13|H=|N=2
| Appearance =
| Appearance =
| Odor = faint, [[amine]]-like<ref name=PGCH/>
| Density = 1.05 g/cm<sup>3</sup> (100°C)
| Density = 1.05 g/cm<sup>3</sup> (100°C)
| MeltingPtC = 89
| MeltingPtC = 89
| BoilingPtCL = 398
| = 398
| BoilingPtCH = 399
| Solubility = 0.125 g/100 ml (20 °C)
| Solubility = 0.125 g/100 ml (20 °C)
| RefractIndex =
| RefractIndex =
| VaporPressure = 0.0000002 mmHg (20°C)<ref name=PGCH/>
| SpecificSurfaceArea =
}}
| PoreVolume =
| Section3 = {{Chembox Hazards
| Average Pore Size = }}
| GHSPictograms = {{GHS health hazard}} {{GHS exclamation mark}} {{GHS environment}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|373|317|341|350|370|411}}<ref name="GESTIS">{{GESTIS|ZVG=26450 |CAS=101-77-9 |Name=4,4'-Diaminodiphenylmethane |Date=12 February 2021}}</ref>
| PPhrases = {{P-phrases|201|260|273|280|308+313}}<ref name=GESTIS/>
| MainHazards = potential carcinogen<ref name=PGCH>{{PGCH|0415}}</ref>
| PEL = TWA 0.010 ppm ST 0.100 ppm<ref name=PGCH/>
| FlashPtF = 374
| FlashPt_ref = <ref name=PGCH/>
| REL = Ca<ref name=PGCH/>
| IDLH = Ca [N.D.]<ref name=PGCH/>
}}
}}
}}


'''4,4′-Methylenedianiline''' ('''MDA''') is an organic [[Chemical compound|compound]] with the formula {{chem2|CH2(C6H4NH2)2}}. It is a colorless solid, although commercial samples can appear yellow or brown. It is produced on an industrial scale, mainly as a precursor to [[polyurethane]]s.
'''4,4'-Methylenedianiline''' ('''MDA''') is a suspected [[carcinogen]].<ref name=atsdr>[http://www.atsdr.cdc.gov/toxfaqs/tf.asp?id=1000&tid=210 ToxFAQs for 4,4'-Methylenedianiline], Agency for Toxic Substances and Disease Registry</ref>
It is included in the "[[SVHC|substances of very high concern]]" list of the European Chemicals Agency ([[ECHA]])<ref name=ECHA>Background document for 4,4’-Diaminodiphenylmethane (MDA)[http://echa.europa.eu/doc/authorisation/annex_xiv_rec/subs_spec_background_docs/mda.pdf]</ref>.


== Synthesis ==
== Synthesis ==
In the industrial production, MDA is synthesised by reaction of formaldehyde and aniline in the presence of hydrochloric acid<ref name=industr_prodn>Data on manufacture, import, export, uses and release of 4-4’ diaminodiphenylmethane as well as ... [http://echa.europa.eu/doc/consultations/recommendations/tech_reports/tech_rep_mda.pdf]</ref>.
In the industrial production, MDA is by reaction of formaldehyde and aniline in the presence of hydrochloric acid<ref name=industr_prodn>Data on manufacture, import, export, uses and release of 4- diaminodiphenylmethane ... http://echa.europa.eu/doc/consultations/recommendations/tech_reports/tech_rep_mda.pdf</ref>


MDA is a common monomer in the synthesis of polymer materials. These include polyamides,<ref>{{cite journal |doi=10.1021/acsomega.1c06983 |title= Direct Synthesis of Thermally Stable Semiaromatic Polyamides by Bulk Polymerization Using Aromatic Diamines and Aliphatic Dicarboxylic Acids | first1 = Taiki |last1 = Endo | first2 = Tomoya | last2 = Higashihara |journal = ACS Omega |year = 2022 |volume = 7 |issue = 10 |pages = 8753–8758|doi-access = free |pmid= 35309482 |pmc = 8928493 }}</ref> polyimides and polyimines.<ref>{{cite journal |doi=10.1021/acs.macromol.2c01595 |title= Raman Spectroscopy Reveals Phase Separation in Imine-Based Covalent Adaptable Networks |first1= S.K. |last1=Schoustra | first2 = M.H.P. | last2= De Heer Kloots | first3 = J. | last3 = Posthuma | first4 = D. | last4 = Van Doorn | first5 = J.A. | last5 = Dijksman | first6= M.M.J. |last6= Smulders |journal= Macromolecules |year= 2022 |volume= 55 |issue= 23 |pages= 10341–10355 |doi-access= free |pmid= 36530523 |pmc= 9753755 |bibcode= 2022MaMol..5510341S }}</ref> MDA is also used extensively as a precursor to [[methylene diphenyl diisocyanate]] (MDI). Here, MDA is treated with [[phosgene]] to produce MDI. MDI, in turn, is a precursor to many [[polyurethane]] foams.<ref name=atsdr/><ref name=ECHA/> Lower quantities are used as hardeners in epoxy resins and adhesives, as well as in the production of high-performance polymers.<ref name=industr_prodn /> Additionally, hydrogenation of MDA can be performed to produce [[4,4'-Diaminodicyclohexylmethane|4,4,diaminodicyclohexylmethane]], which is also used in polymer chemistry.<ref name=Ullmannamine>{{cite encyclopedia| vauthors = Roose P, Eller K, Henkes E, Rossbacher R, Höke H |title=Amines, Aliphatic|encyclopedia=Ullmann’s Encyclopedia of Industrial Chemistry|year=2005|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.a02_001|isbn=3-527-30673-0}}</ref>
==Uses==
MDA is used mainly for making [[polyurethane]] foams.<ref name=atsdr/> Lower quantities are used as hardeners in epoxy resins and adhesives, as well as in the production of high-performance polymers<ref name=industr_prodn></ref>.


MDA can also be applied as a bidentate (bridging) ligand in the formation of metal-coordination complexes.<ref>{{cite journal | title=Six transition metal–organic materials with the ditopic 4,4′-diaminodiphenylmethane ligand: Synthesis, structure characterization and luminescent properties | last1=Chisca | first1=D. |last2=Croitor|first2=L.|last3=Melnic|first3=E.|last4=Petuhov|first4=O.|last5=Kulikova|first5=O.|last6=Fonari|first6=M. S.| journal=Polyhedron|year=2020|volume=192|pages=114844|doi=10.1016/j.poly.2020.114844 }}</ref>
==References==
{{reflist}}


==External links==
====
MDA is considered a potential occupational carcinogen by the [[National Institute for Occupational Safety and Health|US National Institute for Occupational Safety and Health]]. The [[Occupational Safety and Health Administration]] has set a [[permissible exposure limit]] at 0.01 ppm over an eight-hour time-weighted average, and a [[short-term exposure limit]] at 0.1 ppm.<ref name=pocket>{{cite web | title = 4,4'-Methylenedianiline | url = https://www.cdc.gov/niosh/npg/npgd0415.html | work = NIOSH Pocket Guide on Chemical Hazards }}</ref>
* [[International Labor Organisation]] [http://www.inchem.org/documents/icsc/icsc/eics1111.htm icsc1111]
* [http://ecb.jrc.it/DOCUMENTS/Existing-Chemicals/RISK_ASSESSMENT/REPORT/mdareport008.pdf European Union Risk Assessment Report]
* J.H. Petersen, S.K. Mortensen, G.A. Pedersen, Memorandum for the Danish Veterinary and Food Administration on [http://www.dfvf.dk/Admin/Public/DWSDownload.aspx?File=Files%2FFiler%2FF%C3%B8devaresikkerhed%2FMaterialer+og+genstande%2FPAA_from_black_nylon_cooking_utentils_2004.pdf An acute case of primary aromatic amines migrating from cooking utensils], Danish Institute for Food and Veterinary Research, 12 October 2004


It is suspected [[carcinogen]].<ref name=atsdr>{{cite web | url = https://wwwn.cdc.gov/TSP/ToxFAQs/ToxFAQsLanding.aspx?id=1000&tid=210 | title = ToxFAQs for 4,4'-Methylenedianiline | publisher = Agency for Toxic Substances and Disease Registry }}</ref> It is included in the "[[SVHC|substances of very high concern]]" list of the European Chemicals Agency ([[ECHA]]).<ref name=ECHA>{{cite web | url = http://echa.europa.eu/documents/10162/13640/mda_en.pdf | title = Background document for 4,4'-Diaminodiphenylmethane (MDA) | publisher = European Chemicals Agency | access-date = 2015-02-24 | archive-date = 2017-08-22 | archive-url = https://web.archive.org/web/20170822174713/https://echa.europa.eu/documents/10162/13640/mda_en.pdf | url-status = dead }}</ref> The compound was blamed in a mass poisoning in the vicinity of [[Epping, Essex|Epping]], [[Essex]], United Kingdom during 1965 during which 84 individuals were poisoned through accidental contamination of flour used to make bread.<ref name=NCBI>{{cite journal | vauthors = Kopelman H, Robertson MH, Sanders PG, Ash I | title = The Epping jaundice | journal = British Medical Journal | volume = 1 | issue = 5486 | pages = 514–6 | date = February 1966 | pmid = 5902696 | pmc = 1843808 | doi = 10.1136/bmj.1.5486.514 }}</ref>


==Related compounds==
{{DEFAULTSORT:Methylenedianiline, 4,4'-}}
* [[4,4'-Thiodianiline]]
{{aromatic-stub}}
* [[4,4'-Oxydianiline]]
* [[Dapsone]]


==References==
[[Category:Anilines]]
{{reflist}}
[[Category:IARC Group 2B carcinogens]]


== External links ==
[[cs:4,4'- Diaminodifenylmethan]]
* International http://www.inchem.org/documents/icsc/icsc/eics1111.htm icsc1111
[[de:4,4′-Diaminodiphenylmethan]]
* {{cite web | publisher = Centers for Disease Control and Prevention | url = https://www.cdc.gov/niosh/npg/npgd0415.html | title = NIOSH Pocket Guide to Chemical Hazards }}
[[fr:4,4'-diaminodiphénylméthane]]
* {{cite web | url = http://ecb.jrc.it/DOCUMENTS/Existing-Chemicals/RISK_ASSESSMENT/REPORT/mdareport008.pdf | title = European Union Risk Assessment Report | archive-url = https://web.archive.org/web/20070317063316/http://ecb.jrc.it/DOCUMENTS/Existing-Chemicals/RISK_ASSESSMENT/REPORT/mdareport008.pdf | archive-date = 2007-03-17 }}
[[nl:4,4'-methyleendianiline]]
* Petersen, , Pedersen Memorandum for the Danish Veterinary and Food Administration on http://www.dfvf.dk/Admin/Public/DWSDownload.aspx?File=Files%2FFiler%2FF%C3%B8devaresikkerhed%2FMaterialer+og+genstande%2FPAA_from_black_nylon_cooking_utentils_2004.pdf An acute case of primary aromatic amines migrating from cooking utensils Danish Institute for Food and Veterinary Research 12 October 2004
[[pl:4,4'-Diaminodifenylometan]]

[[fi:4,4'-metyleenidianiliini]]
{{DEFAULTSORT:Methylenedianiline, 4,4'-}}
[[Category:4-Aminophenyl compounds]]
[[Category:IARC Group 2B carcinogens]]
[[Category:]]