Jump to content

EGLU: Difference between revisions

Content deleted Content added
m Journal cites:, added 1 DOI, using AWB (7806)
 
(24 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| verifiedrevid = 400017499
| Verifiedfields = changed
| IUPAC_name = (2S)-2-amino-2-ethylpentanedioic acid
| Watchedfields = changed
| image = Salpha_ethylglutamic_acid.png
| verifiedrevid =
| width = 160
| IUPAC_name = ()-2--2-ethylpentanedioic acid
| CAS_number =
| image = (2S)-α-ethylglutamic acid.svg
| ATC_prefix =
| width = 200
| ATC_suffix =

| PubChem = 5311079
<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability
| protein_bound
| metabolism
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|yes}}
| CAS_number =
| ATC_prefix
| ATC_suffix
| PubChem = 5311079
| IUPHAR_ligand = 1400
| IUPHAR_ligand = 1400
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| C=7|H=13|N=1|O=4
| ChemSpiderID = 4470613
| molecular_weight = 175.182 g/mol
| smiles = O=C(O)CC[C@](N)(C(=O)O)CC
| bioavailability =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| protein_bound =
| StdInChI = 1S/C7H13NO4/c1-2-7(8,6(11)12)4-3-5(9)10/h2-4,8H2,1H3,(H,9,10)(H,11,12)/t7-/m0/s1
| metabolism =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| elimination_half-life =
| excretion =
| =

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
<!--Chemical data-->
| pregnancy_US = <!-- A / B / C / D / X -->
| C=7|H=13|N=1|O=4
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''(2S)-α-Ethylglutamic acid''' ('''EGLU''') is a drug that is used in neuroscience research. It was one of the first compounds found that acts as a selective antagonist for the group II metabotropic glutamate receptors ([[Metabotropic glutamate receptor|mGluR<sub>2/3</sub>]]), and so has been useful in the characterisation and study of this receptor subfamily.<ref>{{cite journal | last1 = Jane | first1 = DE | last2 = Thomas | first2 = NK | last3 = Tse | first3 = HW | last4 = Watkins | first4 = JC | title = Potent antagonists at the L-AP4- and (1S,3S)-ACPD-sensitive presynaptic metabotropic glutamate receptors in the neonatal rat spinal cord | journal = Neuropharmacology | volume = 35 | issue = 8 | pages = 1029–35 | year = 1996 | pmid = 9121605 }}</ref><ref>{{cite journal | last1 = Huang | first1 = L | last2 = Rowan | first2 = MJ | last3 = Anwyl | first3 = R | title = Induction of long-lasting depression by (+)-alpha-methyl-4-carboxyphenylglycine and other group II mGlu receptor ligands in the dentate gyrus of the hippocampus in vitro | journal = European journal of pharmacology | volume = 366 | issue = 2-3 | pages = 151–8 | year = 1999 | pmid = 10082195 | doi=10.1016/S0014-2999(98)00918-2}}</ref><ref>{{cite journal | last1 = Palazzo | first1 = E | last2 = Marabese | first2 = I | last3 = De Novellis | first3 = V | last4 = Oliva | first4 = P | last5 = Rossi | first5 = F | last6 = Berrino | first6 = L | last7 = Rossi | first7 = F | last8 = Maione | first8 = S | title = Metabotropic and NMDA glutamate receptors participate in the cannabinoid-induced antinociception | journal = Neuropharmacology | volume = 40 | issue = 3 | pages = 319–26 | year = 2001 | pmid = 11166324 | doi=10.1016/S0028-3908(00)00160-X}}</ref><ref>{{cite journal | last1 = Iserhot | first1 = C | last2 = Gebhardt | first2 = C | last3 = Schmitz | first3 = D | last4 = Heinemann | first4 = U | title = Glutamate transporters and metabotropic receptors regulate excitatory neurotransmission in the medial entorhinal cortex of the rat | journal = Brain research | volume = 1027 | issue = 1-2 | pages = 151–60 | year = 2004 | pmid = 15494166 | doi = 10.1016/j.brainres.2004.08.052 }}</ref><ref>{{cite journal | last1 = Cahusac | first1 = PM | last2 = Wan | first2 = H | title = Group II metabotropic glutamate receptors reduce excitatory but not inhibitory neurotransmission in rat barrel cortex in vivo | journal = Neuroscience | volume = 146 | issue = 1 | pages = 202–12 | year = 2007 | pmid = 17346894 | doi = 10.1016/j.neuroscience.2007.01.049 }}</ref><ref>{{cite journal | last1 = Kim | first1 = WY | last2 = Vezina | first2 = P | last3 = Kim | first3 = JH | title = Blockade of group II, but not group I, mGluRs in the rat nucleus accumbens inhibits the expression of conditioned hyperactivity in an amphetamine-associated environment | journal = Behavioural brain research | volume = 191 | issue = 1 | pages = 62–6 | year = 2008 | pmid = 18433894 | doi = 10.1016/j.bbr.2008.03.010 }}</ref><ref>{{cite journal | last1 = Altinbilek | first1 = B | last2 = Manahan-Vaughan | first2 = D | title = A specific role for group II metabotropic glutamate receptors in hippocampal long-term depression and spatial memory | journal = Neuroscience | volume = 158 | issue = 1 | pages = 149–58 | year = 2009 | pmid = 18722513 | doi = 10.1016/j.neuroscience.2008.07.045 }}</ref>
'''(2S)-α- acid''' ) is a drug that is used in neuroscience research. It was one of the first compounds found that acts as a selective antagonist for the group II metabotropic glutamate receptors (mGluR<sub>2/3</sub>), and so has been useful in the and study of this receptor subfamily.<ref>{{cite journal | = Jane DE Thomas NK Tse HW Watkins JC | title = Potent antagonists at the L-AP4- and (1S,3S)-ACPD-sensitive presynaptic metabotropic glutamate receptors in the neonatal rat spinal cord | journal = Neuropharmacology | volume = 35 | issue = 8 | pages = 1029–35 | year = 1996 | pmid = 9121605 }}</ref><ref>{{cite journal | = Huang L Rowan MJ Anwyl R | title = Induction of long-lasting depression by (+)-alpha-methyl-4-carboxyphenylglycine and other group II mGlu receptor ligands in the dentate gyrus of the hippocampus in vitro | journal = European of | volume = 366 | issue = | pages = 151–8 | = 1999 | pmid = 10082195 | doi=10.1016/S0014-2999(98)00918-2}}</ref><ref>{{cite journal | = Palazzo E Marabese I Novellis V Oliva P Rossi F Berrino L Rossi F | = | title = Metabotropic and NMDA glutamate receptors participate in the cannabinoid-induced antinociception | journal = Neuropharmacology | volume = 40 | issue = 3 | pages = 319–26 | = 2001 | pmid = 11166324 | doi=10.1016/S0028-3908(00)00160-X}}</ref><ref>{{cite journal | = Iserhot C Gebhardt C Schmitz D Heinemann U | title = Glutamate transporters and metabotropic receptors regulate excitatory neurotransmission in the medial entorhinal cortex of the rat | journal = Brain | volume = 1027 | issue = | pages = 151–60 | = 2004 | pmid = 15494166 | doi = 10.1016/j.brainres.2004.08.052 }}</ref><ref>{{cite journal | = Cahusac PM Wan H | title = Group II metabotropic glutamate receptors reduce excitatory but not inhibitory neurotransmission in rat barrel cortex in vivo | journal = Neuroscience | volume = 146 | issue = 1 | pages = 202–12 | = 2007 | pmid = 17346894 | doi = 10.1016/j.neuroscience.2007.01.049 }}</ref><ref>{{cite journal | = Kim WY Vezina P Kim JH | title = Blockade of group II, but not group I, mGluRs in the rat nucleus accumbens inhibits the expression of conditioned hyperactivity in an amphetamine-associated environment | journal = Behavioural | volume = 191 | issue = 1 | pages = 62–6 | = 2008 | pmid = 18433894 | doi = 10.1016/j.bbr.2008.03.010 }}</ref><ref>{{cite journal | = Altinbilek B Manahan-Vaughan D | title = A specific role for group II metabotropic glutamate receptors in hippocampal long-term depression and spatial memory | journal = Neuroscience | volume = 158 | issue = 1 | pages = 149–58 | = 2009 | pmid = 18722513 | doi = 10.1016/j.neuroscience.2008.07.045 }}</ref>


== References ==
== References ==
{{Reflist|2}}
<references/>

{{Glutamate_receptor_ligands}}


{{Metabotropic glutamate receptor modulators}}
[[Category:Neuroscience]]


[[Category:MGlu2 receptor antagonists]]
[[Category:MGlu3 receptor antagonists]]
[[Category:]]


{{pharmacology-stub}}
{{-stub}}