EGLU: Difference between revisions
Appearance
Content deleted Content added
m Journal cites:, added 1 DOI, using AWB (7806) |
Added Category:Glutamic acids |
||
(24 intermediate revisions by 18 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox |
|||
{{Drugbox |
|||
⚫ | |||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
| image = Salpha_ethylglutamic_acid.png |
|||
⚫ | |||
| width = 160 |
|||
⚫ | |||
⚫ | |||
| image = (2S)-α-ethylglutamic acid.svg |
|||
⚫ | |||
| width = 200 |
|||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| excretion = |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|yes}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| IUPHAR_ligand = 1400 |
| IUPHAR_ligand = 1400 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank |
| DrugBank |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
⚫ | |||
| ChemSpiderID = 4470613 |
|||
| molecular_weight = 175.182 g/mol |
|||
| smiles = O=C(O)CC[C@](N)(C(=O)O)CC |
|||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
⚫ | |||
| StdInChI = 1S/C7H13NO4/c1-2-7(8,6(11)12)4-3-5(9)10/h2-4,8H2,1H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
|||
⚫ | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
⚫ | |||
| |
| = |
||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''(2S)-α- |
'''(2S)-α- acid''' ) is a drug that is used in neuroscience research. It was one of the first compounds found that acts as a selective antagonist for the group II metabotropic glutamate receptors (mGluR<sub>2/3</sub>), and so has been useful in the and study of this receptor subfamily.<ref>{{cite journal | = Jane DE Thomas NK Tse HW Watkins JC | title = Potent antagonists at the L-AP4- and (1S,3S)-ACPD-sensitive presynaptic metabotropic glutamate receptors in the neonatal rat spinal cord | journal = Neuropharmacology | volume = 35 | issue = 8 | pages = 1029–35 | year = 1996 | pmid = 9121605 }}</ref><ref>{{cite journal | = Huang L Rowan MJ Anwyl R | title = Induction of long-lasting depression by (+)-alpha-methyl-4-carboxyphenylglycine and other group II mGlu receptor ligands in the dentate gyrus of the hippocampus in vitro | journal = European of | volume = 366 | issue = | pages = 151–8 | = 1999 | pmid = 10082195 | doi=10.1016/S0014-2999(98)00918-2}}</ref><ref>{{cite journal | = Palazzo E Marabese I Novellis V Oliva P Rossi F Berrino L Rossi F | = | title = Metabotropic and NMDA glutamate receptors participate in the cannabinoid-induced antinociception | journal = Neuropharmacology | volume = 40 | issue = 3 | pages = 319–26 | = 2001 | pmid = 11166324 | doi=10.1016/S0028-3908(00)00160-X}}</ref><ref>{{cite journal | = Iserhot C Gebhardt C Schmitz D Heinemann U | title = Glutamate transporters and metabotropic receptors regulate excitatory neurotransmission in the medial entorhinal cortex of the rat | journal = Brain | volume = 1027 | issue = | pages = 151–60 | = 2004 | pmid = 15494166 | doi = 10.1016/j.brainres.2004.08.052 }}</ref><ref>{{cite journal | = Cahusac PM Wan H | title = Group II metabotropic glutamate receptors reduce excitatory but not inhibitory neurotransmission in rat barrel cortex in vivo | journal = Neuroscience | volume = 146 | issue = 1 | pages = 202–12 | = 2007 | pmid = 17346894 | doi = 10.1016/j.neuroscience.2007.01.049 }}</ref><ref>{{cite journal | = Kim WY Vezina P Kim JH | title = Blockade of group II, but not group I, mGluRs in the rat nucleus accumbens inhibits the expression of conditioned hyperactivity in an amphetamine-associated environment | journal = Behavioural | volume = 191 | issue = 1 | pages = 62–6 | = 2008 | pmid = 18433894 | doi = 10.1016/j.bbr.2008.03.010 }}</ref><ref>{{cite journal | = Altinbilek B Manahan-Vaughan D | title = A specific role for group II metabotropic glutamate receptors in hippocampal long-term depression and spatial memory | journal = Neuroscience | volume = 158 | issue = 1 | pages = 149–58 | = 2009 | pmid = 18722513 | doi = 10.1016/j.neuroscience.2008.07.045 }}</ref> |
||
== References == |
== References == |
||
{{Reflist|2}} |
|||
<references/> |
|||
{{Glutamate_receptor_ligands}} |
|||
{{Metabotropic glutamate receptor modulators}} |
|||
⚫ | |||
[[Category:MGlu2 receptor antagonists]] |
|||
[[Category:MGlu3 receptor antagonists]] |
|||
⚫ | |||
{{ |
{{-stub}} |