Neomogroside: Difference between revisions
Appearance
Content deleted Content added
m r2.7.1) (robot Adding: ar:نيوموجروسايد |
m →top: Task 16: replaced (1×) / removed (0×) deprecated |dead-url= and |deadurl= with |url-status=; |
||
(13 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| verifiedrevid = |
| verifiedrevid = |
||
| ImageFile = Neomogroside.png |
| ImageFile = Neomogroside.png |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| IUPACName = |
| IUPACName = |
||
| OtherNames = (3α,9β,10β,11α,24''R'')-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<small>D</small>-glucopyranosyl-(12)-''O''-[β-<small>D</small>-glucopyranosyl]-β-<small>D</small>-glucopyranoside |
| OtherNames = (3α,9β,10β,11α,24''R'')-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<small>D</small>-glucopyranosyl-(12)-''O''-[β-<small>D</small>-glucopyranosyl]-β-<small>D</small>-glucopyranoside |
||
| |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 189307-15-1 |
| CASNo = 189307-15-1 |
||
| PubChem = |
| PubChem = |
||
| ChemSpiderID = 24721801 |
|||
| SMILES = }} |
|||
| SMILES = C[C@H](CC[C@H](C(C)(C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)[C@H]4CC[C@@]5([C@@]4(C[C@H]([C@@]6([C@H]5CC=C7[C@H]6CC[C@@H](C7(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C)O)C)C |
|||
⚫ | |||
| StdInChI = 1S/C66H112O34/c1-24(9-13-37(63(4,5)88)97-55-25(22-89-56-50(84)44(78)39(73)29(18-67)91-56)38(72)49(83)60(99-55)100-59-53(87)47(81)42(76)32(21-70)94-59)26-15-16-64(6)34-12-10-27-28(66(34,8)35(71)17-65(26,64)7)11-14-36(62(27,2)3)96-61-54(98-58-52(86)46(80)41(75)31(20-69)93-58)48(82)43(77)33(95-61)23-90-57-51(85)45(79)40(74)30(19-68)92-57/h10,24-26,28-61,67-88H,9,11-23H2,1-8H3/t24-,25-,26-,28-,29-,30-,31-,32-,33-,34+,35-,36+,37-,38-,39-,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,54-,55-,56-,57-,58+,59+,60-,61+,64+,65-,66+/m1/s1 |
|||
| StdInChIKey = KLARCXPUZABXOZ-SRMPMRICSA-N }} |
|||
⚫ | |||
| C=66 | H=112 | O=34 |
| C=66 | H=112 | O=34 |
||
| Appearance = |
| Appearance = |
||
Line 16: | Line 21: | ||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| = }} |
||
}} |
}} |
||
⚫ | '''Neomogroside''' is a [[cucurbitane]] [[glycoside]] isolated from the fruit of ''[[Siraitia grosvenorii]]''.<ref>{{cite journal | title = Isolation and Determination of Cucurbitane-Glycosides from Fresh Fruits of Siraitia Grosvenorii | journal = Journal of Integrative Plant Biology | volume = 38 | issue = 6 | year = 1996 | pages = 489–494 | = Si Jian-yong Chen Di-hua Chang Qi Shen Lian-gang | url = http://www.jipb.net/earticle_read.asp?id=11284}}</ref> |
||
⚫ | |||
⚫ | '''Neomogroside''' is a [[ |
||
⚫ | |||
* [[Mogroside]] |
* [[Mogroside]] |
||
* [[Siamenoside]] |
* [[Siamenoside]] |
||
Line 31: | Line 35: | ||
{{reflist}} |
{{reflist}} |
||
==External links== |
|||
⚫ | |||
*{{Commonscatinline}} |
|||
[[Category: |
[[Category:]] |
||
[[Category: |
[[Category: ]] |
||
[[Category:Sweeteners]] |
|||
[[ar:نيوموجروسايد]] |
|||
⚫ | |||
[[fr:Néomogroside]] |