Jump to content

Neomogroside: Difference between revisions

Content deleted Content added
WikitanvirBot (talk | contribs)
m r2.7.1) (robot Adding: ar:نيوموجروسايد
Monkbot (talk | contribs)
m top: Task 16: replaced (1×) / removed (0×) deprecated |dead-url= and |deadurl= with |url-status=;
 
(13 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Chembox
{{Chembox
| verifiedrevid = 406417357
| verifiedrevid =
| ImageFile = Neomogroside.png
| ImageFile = Neomogroside.png
| ImageSize = 200px
| ImageSize = 200px
| IUPACName =
| IUPACName =
| OtherNames = (3α,9β,10β,11α,24''R'')-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<small>D</small>-glucopyranosyl-(12)-''O''-[β-<small>D</small>-glucopyranosyl]-β-<small>D</small>-glucopyranoside
| OtherNames = (3α,9β,10β,11α,24''R'')-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<small>D</small>-glucopyranosyl-(12)-''O''-[β-<small>D</small>-glucopyranosyl]-β-<small>D</small>-glucopyranoside
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 189307-15-1
| CASNo = 189307-15-1
| PubChem =
| PubChem =
| ChemSpiderID = 24721801
| SMILES = }}
| SMILES = C[C@H](CC[C@H](C(C)(C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)[C@H]4CC[C@@]5([C@@]4(C[C@H]([C@@]6([C@H]5CC=C7[C@H]6CC[C@@H](C7(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C)O)C)C
| Section2 = {{Chembox Properties
| StdInChI = 1S/C66H112O34/c1-24(9-13-37(63(4,5)88)97-55-25(22-89-56-50(84)44(78)39(73)29(18-67)91-56)38(72)49(83)60(99-55)100-59-53(87)47(81)42(76)32(21-70)94-59)26-15-16-64(6)34-12-10-27-28(66(34,8)35(71)17-65(26,64)7)11-14-36(62(27,2)3)96-61-54(98-58-52(86)46(80)41(75)31(20-69)93-58)48(82)43(77)33(95-61)23-90-57-51(85)45(79)40(74)30(19-68)92-57/h10,24-26,28-61,67-88H,9,11-23H2,1-8H3/t24-,25-,26-,28-,29-,30-,31-,32-,33-,34+,35-,36+,37-,38-,39-,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,54-,55-,56-,57-,58+,59+,60-,61+,64+,65-,66+/m1/s1

| StdInChIKey = KLARCXPUZABXOZ-SRMPMRICSA-N }}
|Section2={{Chembox Properties
| C=66 | H=112 | O=34
| C=66 | H=112 | O=34
| Appearance =
| Appearance =
Line 16: Line 21:
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| = }}
}}
}}
'''Neomogroside''' is a [[cucurbitane]] [[glycoside]] isolated from the fruit of ''[[Siraitia grosvenorii]]''.<ref>{{cite journal | title = Isolation and Determination of Cucurbitane-Glycosides from Fresh Fruits of Siraitia Grosvenorii | journal = Journal of Integrative Plant Biology | volume = 38 | issue = 6 | year = 1996 | pages = 489–494 | = Si Jian-yong Chen Di-hua Chang Qi Shen Lian-gang | url = http://www.jipb.net/earticle_read.asp?id=11284}}</ref>


==See also==
'''Neomogroside''' is a [[Curcubita|cucurbitane]] [[glycoside]] isolated from the fruit of ''[[Siraitia grosvenorii]]''.<ref>{{cite journal | title = Isolation and Determination of Cucurbitane-Glycosides from Fresh Fruits of Siraitia Grosvenorii | journal = Journal of Integrative Plant Biology | volume = 38 | issue = 6 | year = 1996 | pages = 489–494 | author = Si Jian-yong, Chen Di-hua, Chang Qi and Shen Lian-gang | url = http://www.jipb.net/earticle_read.asp?id=11284}}</ref>

==See also==
* [[Mogroside]]
* [[Mogroside]]
* [[Siamenoside]]
* [[Siamenoside]]
Line 31: Line 35:
{{reflist}}
{{reflist}}


==External links==
{{Organic-compound-stub}}
*{{Commonscatinline}}


[[Category:Glycosides]]
[[Category:]]
[[Category:Terpenes and terpenoids]]
[[Category: ]]
[[Category:Sweeteners]]



[[ar:نيوموجروسايد]]
{{Organic-compound-stub}}
[[fr:Néomogroside]]