Jump to content

Sodium methylparaben: Difference between revisions

Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
No edit summary
Tautropfli (talk | contribs)
149 edits
m Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.
 
(26 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{DISPLAYTITLE:Sodium methyl ''para''-hydroxybenzoate}}
{{Chembox
{{Chembox
| verifiedrevid = 425012595
| verifiedrevid =
| Name = Sodium methyl ''para''-hydroxybenzoate
| Name = Sodium
| ImageFile = Sodium methyl para-hydroxybenzoate.svg
| ImageFile = Sodium methyl para-hydroxybenzoate.svg
| ImageSize = 200px
| ImageSize = 200px
| ImageAlt =
| ImageAlt =
| IUPACName = Sodium 4-(methoxycarbonyl)phenolate
| = Sodium 4-(methoxycarbonyl)
| OtherNames = Sodium methyl ''p''-hydroxybenzoate; Methylparaben sodium salt; E219
| OtherNames = Sodium methyl ''p''-hydroxybenzoateMethylparaben sodium saltE219
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 5026-62-0
| CASNo = 5026-62-0
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| EINECS = 225-714-1
| UNII = CR6K9C2NHK
⚫
| PubChem =
| ChEMBL = 2106903
⚫
| SMILES = O=C([O-])C1=CC=C(O)C=C1.[Na+]}}
| ChemSpiderID = 19863
⚫
| Section2 = {{Chembox Properties
⚫
| EINECS = 225-714-1
⚫
| C=8|H=7|O=3|Na=1
| KEGG = D02458
⚫
| Appearance =
⚫
| PubChem =
| Density =
⚫
| SMILES = O=C([O-])C1=CC=C(O)C=C1.[Na+]}}
| MeltingPt =
⚫
|Section2={{Chembox Properties
⚫
| BoilingPt =
⚫
| C=8|H=7|O=3|Na=1
⚫
| Solubility = }}
⚫
| Appearance =
⚫
| Section3 = {{Chembox Hazards
| MainHazards =
| =
| FlashPt =
| =
⚫
| BoilingPt =
| Autoignition = }}
⚫
| Solubility = }}
⚫
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS05}}{{GHS07}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|302|315|318|412}}
| PPhrases = {{P-phrases|264|270|273|280|301+312|302+352|305+351+338|310|321|330|332+313|362|501}}
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
}}


'''Sodium methyl ''para''-hydroxybenzoate''' is a [[Compound (chemistry)|compound]] with formula Na(CH<sub>3</sub>(C<sub>6</sub>H<sub>4</sub>COO)O). It is the [[sodium]] [[salt (chemistry)|salt]] of [[methylparaben]].
'''Sodium methyl ''para''-hydroxybenzoate''' is a [[Compound (chemistry)|compound]] with formula Na(CH<sub>3</sub>(C<sub>6</sub>H<sub>4</sub>COO)O). It is the [[sodium]] [[salt (chemistry)|salt]] of [[methylparaben]].


It is a food additive with the [[E number]] E219 which is used as a preservative.
It is a food additive with the [[E number]] E219 which is used as a preservative.


==References==
==References==
{{Reflist}}
{{Unreferenced|date=April 2011}}


[[Category:Benzoates]]
[[Category:]]
[[Category:Sodium compounds]]
[[Category: ]]
[[Category:Food additives]]
[[Category:Food additives]]
[[Category:Methyl esters]]
[[Category:Methyl esters]]
[[Category:E-number additives]]
[[Category:Phenolates]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"