Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Ulobetasol: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 456822786 of page Ulobetasol for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').
 
m +WL Duobrii (w/ piping to Halobetasol/tazarotene)
 
Line 1: Line 1:
{{short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Ulobetasol|oldid=456822786}} 456822786] of page [[Ulobetasol]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| verifiedrevid = 409091935
| verifiedrevid =
| image = Ulobetasol.svg
⚫
| IUPAC_name = (6α,11β,16β)-21-chloro-6,9-difluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione
| image = Ulobetasol.png
| =


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| Drugs.com = {{drugs.com|CONS|ulobetasol}}
| Drugs.com = {{drugs.com||}}
| MedlinePlus = a601060
| MedlinePlus = a601060
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
Line 27: Line 27:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite||??}}
| CAS_number = <!-- blanked - oldvalue: 98651-66-2 -->
| CAS_number = 98651-66-2
| ATC_prefix = D07
| ATC_prefix = D07
| ATC_suffix = AC21
| ATC_suffix = AC21
| ATC_supplemental = <br />{{ATC|D05|AX55}} (combination with [[tazarotene]])
| PubChem = 5311167
| PubChem = 5311167
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4470691
| ChemSpiderID = 4470691
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII_Ref = {{fdacite||FDA}}
| UNII = 9P6159HM7T
| UNII = 9P6159HM7T
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08660
| KEGG = D08660
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1201360 -->
| ChEMBL = 1201360

<!--Chemical data-->
⚫
| IUPAC_name = (6α,11β,16β)-21--6,9-difluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione
| C=22 | H=27 | Cl=1 | F=2 | O=4
| C=22 | H=27 | Cl=1 | F=2 | O=4
| molecular_weight = 428.897
| smiles = ClCC(=O)[C@]3(O)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)[C@@H](F)C[C@H]4[C@@H]2C[C@@H]3C)C)C
| smiles = ClCC(=O)[C@]3(O)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)[C@@H](F)C[C@H]4[C@@H]2C[C@@H]3C)C)C
| InChI = 1/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
| InChIKey = LEHFPXVYPMWYQD-XHIJKXOTBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
| StdInChI = 1S/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LEHFPXVYPMWYQD-XHIJKXOTSA-N
| StdInChIKey = LEHFPXVYPMWYQD-XHIJKXOTSA-N
| synonyms = <small>(6''S'',8''S'',9''S'',10''S'',11''S'',13''S'',14''S'',16''S'',17''R'')-17-(2-Chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one</small>
| synonyms = (6''S'',8''S'',9''S'',10''S'',11''S'',13''S'',14''S'',16''S'',17''R'')-17-(2-Chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one
}}
}}

'''Ulobetasol''' ([[International Nonproprietary Name|INN]]) or '''halobetasol''' ([[United States Adopted Name|USAN]]) is a [[corticosteroid]] used to treat [[psoriasis]].<ref name="monograph">{{cite web|url=https://pdf.hres.ca/dpd_pm/00053569.PDF|title=Ultravate product monograph|access-date=2021-01-04}}</ref><ref>{{DrugBank|DB00596}}. Retrieved 2020-01-04.</ref> It is a class I corticosteroid under the US classification and a group III corticosteroid under international classification, the most potent group of such drugs.<ref>{{cite journal | vauthors = Pearce DJ, Spencer L, Hu J, Balkrishnan R, Fleischer AB, Feldman SR | title = Class I topical corticosteroid use by psoriasis patients in an academic practice | journal = The Journal of Dermatological Treatment | volume = 15 | issue = 4 | pages = 235–8 | date = July 2004 | pmid = 15764038 | doi = 10.1080/09546630410033745 | s2cid = 2757493 }}</ref><ref>ATC code {{ATC|D07|AC21}}. Retrieved 2020-01-04.</ref>

[[Ulobetasol propionate]] is usually supplied as a 0.05% topical cream.<ref name="monograph" /> Ulobetasol is the strongest topical steroid available.{{cn|date=February 2017}} It is also sold with [[tazarotene]] with 0.01% halobetasol and 0.045% [[tazarotene]] as a lotion branded as [[halobetasol/tazarotene|Duobrii]] (Bausch Health).

It is available as a [[generic medication]].<ref>{{cite web | title=Ulobetasol international | website=Drugs.com | date=10 August 2020 | url=https://www.drugs.com/international/ulobetasol.html | access-date=15 August 2020}}</ref>

== References ==
{{reflist}}

== External links ==
* {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/rn/98651-66-2 | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Halobetasol }}
* {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/name/halobetasol%20propionate | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Halobetasol propionate }}
* {{MeshName|halobetasol}}

{{Glucocorticoids}}
{{Glucocorticoidics}}
{{Portal bar | Medicine}}

[[Category:Glucocorticoids]]
[[Category:Organofluorides]]
[[Category:Organochlorides]]
[[Category:Alcohols]]
[[Category:Ketones]]
[[Category:Halohydrins]]

{{dermatologic-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"